Product Parameters
1. Names and Identifiers
| Name | 4-Aminobutyric acid |
| CAS | No.56-12-2 |
| CID | 119 |
| EINECS(EC#) | 200-258-6 |
| Molecular Formula | C4H9NO2 (isomer) |
| Inchi | InChI=1S/C4H9NO2/c5-3-1-2-4(6)7/h1-3,5H2,(H,6,7) |
| InChIkey | BTCSSZJGUNDROE-UHFFFAOYSA-N |
| Canonical Smiles | C(CC(=O)O)CN |
| Isomers Smiles | C(CC(=O)O)CN |
Properties
| Density | 1.2300 (estimate) |
| Melting point | 195?°C (dec.)(lit.) |
| Boiling point | 248oC at 760 mmHg |
| Refractive index | 1.4650 (estimate) |
| Flash Point | 103.8oC |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Precise Quality | 103.06300 |
| PSA | 63.32000 |
| logP | 0.51020 |
| Solubility | H2O: 1?M at?20?°C, clear, colorless |
| Appearance | H2O: 1?M at?20?°C, clear, colorless |
| Storage | Ambient temperatures. |
| Chemical Properties | White, powdery solid; savory, meat-like aroma |
| Color/Form | White to almost white |
| PKa | 4.031(at 25℃) |
| Water Solubility | H2O: 1?M at?20?°C, clear, colorless | SOLUBLE |
| Stability | Stable under normal temperatures and pressures. |
| StorageTemp | Store at RT. |
Product Application
4‑Aminobutyric acid acts as a pharmaceutical intermediate with lipid‑lowering properties, which renders it useful for preventing and treating various forms of hepatic coma. It may also be applied for poliomyelitis and cerebral hemorrhage treatment, and functions as an antidote for gas poisoning. Furthermore, it enjoys broad employment in biochemical research and organic synthesis.
This compound helps cut down blood ammonia concentrations and boosts cerebral metabolism. It delivers therapeutic benefits for multiple kinds of hepatic coma, as well as comas stemming from post‑stroke sequelae, cerebral arteriosclerosis, sequelae of head injury, uremia and gas intoxication.
As the primary inhibitory neurotransmitter inside the brain, it serves as an agonist of both GABAA and GABAB receptors, raising chloride ion (Cl⁻) conductance.
